Systematic / IUPAC Name: Cyclohexanecarboxylic acid
ID: Reference2728
Other Names:
Benzoic acid, hexahydro-;
Hexahydrobenzoic acid;
1-Cyclohexanecarboxylic acid;
Carboxycyclohexane;
Cyclohexanoic acid
; more
Formula: C7H12O2
Class: Extractables/Leachables Industrial Chemicals Excipients/Additives/Colorants
Cyclohexanecarboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 197 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/2/2015 2:09:23 PM |
| InChI | InChI=1S/C7H12O2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2,(H,8,9) |
| InChI Key | NZNMSOFKMUBTKW-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)C(=O)O |
| CAS | 98895 |
| Splash | |
| Other Names |
Benzoic acid, hexahydro-; Hexahydrobenzoic acid; 1-Cyclohexanecarboxylic acid; Carboxycyclohexane; Cyclohexanoic acid; Cyclohexylcarboxylic acid; Cyclohexylformic acid; Cyclohexylmethanoic acid |