Systematic / IUPAC Name: N-[4-({(5Z)-5-[2-(1,4'-Bipiperidin-1'-yl)-2-oxoethylidene]-4,4-difluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl}carbonyl)phenyl]-2-methyl-3-furamide
ID: Reference2762
Other Names: 3-Furancarboxamide, N-[4-({(5Z)-5-[2-(1,4'-bipiperidin)-1'-yl-2-oxoethylidene]-4,4-difluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl}carbonyl)phenyl]-2-methyl-
Formula: C35H38F2N4O4
YM218 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 237 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/3/2015 11:37:21 AM |
| InChI | InChI=1S/C35H38F2N4O4/c1-24-28(15-22-45-24)33(43)38-26-11-9-25(10-12-26)34(44)41-21-16-35(36,37)30(29-7-3-4-8-31(29)41)23-32(42)40-19-13-27(14-20-40)39-17-5-2-6-18-39/h3-4,7-12,15,22-23,27H,2,5-6,13-14,16-21H2,1H3,(H,38,43)/b30-23- |
| InChI Key | VDUUABBYYOPFAW-WMMMYUQOSA-N |
| Canonical SMILES | CC1=C(C=CO1)C(=O)NC2=CC=C(C=C2)C(=O)N3CCC(C(=CC(=O)N4CCC(CC4)N5CCCCC5)C6=CC=CC=C63)(F)F |
| CAS | |
| Splash | |
| Other Names | 3-Furancarboxamide, N-[4-({(5Z)-5-[2-(1,4'-bipiperidin)-1'-yl-2-oxoethylidene]-4,4-difluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl}carbonyl)phenyl]-2-methyl- |
| ChemSpider | 8092672 |
| ChEMBL | CHEMBL3307200 |
| PubChem | 9917025 |