Systematic / IUPAC Name: (7α,17β)-7,17-Dihydroxyandrost-4-en-3-one
ID: Reference278
Other Names:
Androst-4-en-3-one, 7,17-dihydroxy-, (7α,17β)-;
Testosterone, 7α-hydroxy-
Formula: C19H28O3
Class: Endogenous Metabolites
7α-Hydroxytestosterone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 203 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/8/2014 8:02:11 AM |
| InChI | InChI=1S/C19H28O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h9,13-17,21-22H,3-8,10H2,1-2H3/t13-,14-,15+,16-,17-,18-,19-/m0/s1 |
| InChI Key | RNCGWYKXAJCOLD-JUKXBMAYSA-N |
| Canonical SMILES | O=C3\C=C2\CC(O)C1C4C(C)(CCC1C2(C)CC3)C(O)CC4 |
| CAS | 62839 |
| Splash | |
| Other Names |
Androst-4-en-3-one, 7,17-dihydroxy-, (7α,17β)-; Testosterone, 7α-hydroxy- |