Systematic / IUPAC Name: 1-[(2Z)-3-(2-Chloro-3'-methoxy-4-biphenylyl)-2-propen-1-yl]azepane
ID: Reference2787
Other Names: 1H-Azepine, 1-[(2Z)-3-(2-chloro-3'-methoxy[1,1'-biphenyl]-4-yl)-2-propen-1-yl]hexahydro-
Formula: C22H26ClNO
SR125047 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/29/2015 12:42:10 PM |
| InChI | InChI=1S/C22H26ClNO/c1-25-20-10-6-9-19(17-20)21-12-11-18(16-22(21)23)8-7-15-24-13-4-2-3-5-14-24/h6-12,16-17H,2-5,13-15H2,1H3/b8-7- |
| InChI Key | ZDPINFKDQWCRTF-FPLPWBNLSA-N |
| Canonical SMILES | COC1=CC=CC(=C1)C2=C(C=C(C=C2)C=CCN3CCCCCC3)Cl |
| CAS | |
| Splash | |
| Other Names | 1H-Azepine, 1-[(2Z)-3-(2-chloro-3'-methoxy[1,1'-biphenyl]-4-yl)-2-propen-1-yl]hexahydro- |
| PubChem | 9798769 |
| ChemSpider | 7974535 |
| ChEMBL | CHEMBL3302617 |