Systematic / IUPAC Name: 10-Hydroxydecanoic acid
ID: Reference280
Other Names:
Decanoic acid, 10-hydroxy-;
10-Hydroxycapric acid
Formula: C10H20O3
Class: Endogenous Metabolites Personal Care Products/Cosmetics
10-Hydroxydecanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 149 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/8/2014 9:40:05 AM |
| InChI | InChI=1S/C10H20O3/c11-9-7-5-3-1-2-4-6-8-10(12)13/h11H,1-9H2,(H,12,13) |
| InChI Key | YJCJVMMDTBEITC-UHFFFAOYSA-N |
| Canonical SMILES | C(CCCCC(=O)O)CCCCO |
| CAS | 1679534 |
| Splash | |
| Other Names |
Decanoic acid, 10-hydroxy-; 10-Hydroxycapric acid |
| KEGG | C02774 |
| ChemSpider | 66903 |
| LipidsMAPs | LMFA01050033 |
| PubChem | 74300 |
| ChemIDPlus | 001679534 |
| Wikipedia | 10-Hydroxydecanoic acid |
| ChEBI | CHEBI:17409 |