Systematic / IUPAC Name: 2-(2-{5-[5-(1-Azepanylmethyl)-2-thienyl]-1,2,4-oxadiazol-3-yl}ethyl)-1H-isoindole-1,3(2H)-dione
ID: Reference2801
Other Names: 1H-Isoindole-1,3(2H)-dione, 2-[2-(5-{5-[(hexahydro-1H-azepin-1-yl)methyl]-2-thienyl}-1,2,4-oxadiazol-3-yl)ethyl]-
Formula: C23H24N4O3S
PharmaGSID 48172 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/29/2015 12:57:32 PM |
| InChI | InChI=1S/C23H24N4O3S/c28-22-17-7-3-4-8-18(17)23(29)27(22)14-11-20-24-21(30-25-20)19-10-9-16(31-19)15-26-12-5-1-2-6-13-26/h3-4,7-10H,1-2,5-6,11-15H2 |
| InChI Key | QUKKMGJVXHURCY-UHFFFAOYSA-N |
| Canonical SMILES | C1CCCN(CC1)CC2=CC=C(S2)C3=NC(=NO3)CCN4C(=O)C5=CC=CC=C5C4=O |
| CAS | |
| Splash | |
| Other Names | 1H-Isoindole-1,3(2H)-dione, 2-[2-(5-{5-[(hexahydro-1H-azepin-1-yl)methyl]-2-thienyl}-1,2,4-oxadiazol-3-yl)ethyl]- |
| ChemSpider | 8000092 |
| ChEMBL | CHEMBL3301767 |
| PubChem | 9824345 |