Systematic / IUPAC Name: Dibutyl adipate
ID: Reference2822
Other Names:
Adimoll DB;
Cetiol B;
Experimental tick repellent 3;
Polycizer W 260;
Unitolate B
; more
Formula: C14H26O4
Class: Extractables/Leachables Personal Care Products/Cosmetics Textile Chemicals/Auxiliary/Dyes Industrial Chemicals
Dibutyl hexanedioate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/29/2018 10:05:28 AM |
| InChI | InChI=1S/C14H26O4/c1-3-5-11-17-13(15)9-7-8-10-14(16)18-12-6-4-2/h3-12H2,1-2H3 |
| InChI Key | XTJFFFGAUHQWII-UHFFFAOYSA-N |
| Canonical SMILES | CCCCOC(=O)CCCCC(=O)OCCCC |
| CAS | 105997 |
| Splash | |
| Other Names |
Adimoll DB; Cetiol B; Experimental tick repellent 3; Polycizer W 260; Unitolate B; 1,4-Butanedicarboxylic acid, di-n-butylester; 1,6-Dibutyl hexanedioate; Adipic acid di-n-butyl ester; Adipic acid dibutyl ester; Butyl adipate; di-n-Butyl adipate; Dibutyl adipinate; Dibutyl hexane-1,6-dioate; Hexanedioic acid, 1,6-dibutyl ester; Hexanedioic acid, dibutyl ester |
| ChEMBL | CHEMBL3188143 |
| PubChem | 7784 |
| ChemIDPlus | 000105997 |
| ChemSpider | 7496 |
| KEGG | C14253 |