Systematic / IUPAC Name: (2Z)-4-(3,4-Dichlorophenyl)-2-{[2-(4-methylpiperazin-1-yl)phenyl]methylidene}thiomorpholin-3-one
ID: Reference2832
Other Names:
(2Z)-4-(3,4-Dichlorophenyl)-2-[2-(4-methyl-1-piperazinyl)benzylidene]-3-thiomorpholinone;
3-Thiomorpholinone, 4-(3,4-dichlorophenyl)-2-{[2-(4-methyl-1-piperazinyl)phenyl]methylene}-, (2Z)-
Formula: C22H23Cl2N3OS
Class: Therapeutics/Prescription Drugs
Elzasonan mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/19/2015 9:01:19 AM |
| InChI | InChI=1S/C22H23Cl2N3OS/c1-25-8-10-26(11-9-25)20-5-3-2-4-16(20)14-21-22(28)27(12-13-29-21)17-6-7-18(23)19(24)15-17/h2-7,14-15H,8-13H2,1H3/b21-14- |
| InChI Key | LHYMPSWMHXUWSK-STZFKDTASA-N |
| Canonical SMILES | CN1CCN(CC1)C2=CC=CC=C2C=C3C(=O)N(CCS3)C4=CC(=C(C=C4)Cl)Cl |
| CAS | 361343193 |
| Splash | |
| Other Names |
(2Z)-4-(3,4-Dichlorophenyl)-2-[2-(4-methyl-1-piperazinyl)benzylidene]-3-thiomorpholinone; 3-Thiomorpholinone, 4-(3,4-dichlorophenyl)-2-{[2-(4-methyl-1-piperazinyl)phenyl]methylene}-, (2Z)- |
| PubChem | 6914152 |
| ChEMBL | CHEMBL3185463 |
| Wikipedia | Elzasonan |
| ChemSpider | 5290108 |