Systematic / IUPAC Name: 9H-Fluoren-3-ol
ID: Reference2849
Other Names: Fluoren-3-ol
Formula: C13H10O
Class: Endogenous Metabolites
3-Hydroxyfluorene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 6/23/2015 6:13:14 AM |
| InChI | InChI=1S/C13H10O/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11/h1-6,8,14H,7H2 |
| InChI Key | PVUBSZGNXLNTLX-UHFFFAOYSA-N |
| Canonical SMILES | C1C2=C(C=C(C=C2)O)C3=CC=CC=C31 |
| CAS | 6344678 |
| Splash | |
| Other Names | Fluoren-3-ol |
| PubChem | 96088 |
| ChEMBL | CHEMBL3185196 |
| HMDb | HMDB59802 |
| ChemIDPlus | 006344678 |
| ChemSpider | 86734 |