Systematic / IUPAC Name: 1-[2-(3,4-Dichlorophenoxy)-5-fluorophenyl]-N-methylmethanamine
ID: Reference2870
Other Names: Benzenemethanamine, 2-(3,4-dichlorophenoxy)-5-fluoro-N-methyl-
Formula: C14H12Cl2FNO
CP-607366 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/29/2015 12:15:13 PM |
| InChI | InChI=1S/C14H12Cl2FNO/c1-18-8-9-6-10(17)2-5-14(9)19-11-3-4-12(15)13(16)7-11/h2-7,18H,8H2,1H3 |
| InChI Key | FQEBOQLYHASAOY-UHFFFAOYSA-N |
| Canonical SMILES | CNCC1=C(C=CC(=C1)F)OC2=CC(=C(C=C2)Cl)Cl |
| CAS | 289716945 |
| Splash | |
| Other Names | Benzenemethanamine, 2-(3,4-dichlorophenoxy)-5-fluoro-N-methyl- |