Systematic / IUPAC Name: Cyclohexyl(phenyl)methanone
ID: Reference2871
Other Names:
Benzophenone, 1,2,3,4,5,6-hexahydro-;
Benzoylcyclohexane ;
Cyclohexylphenyl ketone;
Cyclohexylphenylmethanone;
Ketone, cyclohexyl phenyl
; more
Formula: C13H16O
Class: Extractables/Leachables
Cyclohexyl phenyl ketone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 3/29/2018 8:18:17 AM |
| InChI | InChI=1S/C13H16O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12H,2,5-6,9-10H2 |
| InChI Key | BMFYCFSWWDXEPB-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)C(=O)C2=CC=CC=C2 |
| CAS | 712505 |
| Splash | |
| Other Names |
Benzophenone, 1,2,3,4,5,6-hexahydro-; Benzoylcyclohexane ; Cyclohexylphenyl ketone; Cyclohexylphenylmethanone; Ketone, cyclohexyl phenyl; Methanone, cyclohexylphenyl-; Phenyl cyclohexyl ketone |
| ChEMBL | CHEMBL3188506 |
| ChemSpider | 12307 |
| PubChem | 12837 |