Systematic / IUPAC Name: 2-[Bis(4-hydroxyphenyl)methyl]benzoic acid
ID: Reference2890
Other Names:
Darmol;
α,α-Bis(4-hydroxyphenyl)-o-toluic acid;
Benzoic acid, 2-[bis(4-hydroxyphenyl)methyl]-
Formula: C20H16O4
Phenolphthalin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 99 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/7/2015 8:56:04 AM |
| InChI | InChI=1S/C20H16O4/c21-15-9-5-13(6-10-15)19(14-7-11-16(22)12-8-14)17-3-1-2-4-18(17)20(23)24/h1-12,19,21-22H,(H,23,24) |
| InChI Key | FFFPYJTVNSSLBQ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)C(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)C(=O)O |
| CAS | 81903 |
| Splash | |
| Other Names |
Darmol; α,α-Bis(4-hydroxyphenyl)-o-toluic acid; Benzoic acid, 2-[bis(4-hydroxyphenyl)methyl]- |
| PubChem | 66494 |
| KEGG | C14223 |
| ChEMBL | CHEMBL1528560 |
| ChemIDPlus | 000081903 |
| ChemSpider | 59865 |
| Wikipedia | Phenolphthalin (DE) |