Systematic / IUPAC Name: 2-O-Benzyl 1-O-butyl benzene-1,2-dicarboxylate
ID: Reference29
Other Names:
Butyl benzyl phthalate;
n-Butyl benzyl phthalate;
Benzyl n-butyl phthalate;
Phthalic acid benzyl butyl ester;
Butyl phenylmethyl 1,2-benzenedicarboxylate
; more
Formula: C19H20O4
Class: Industrial Chemicals
Benzyl butyl phthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 181 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/15/2015 10:31:40 AM |
| InChI | InChI=1S/C19H20O4/c1-2-3-13-22-18(20)16-11-7-8-12-17(16)19(21)23-14-15-9-5-4-6-10-15/h4-12H,2-3,13-14H2,1H3 |
| InChI Key | IRIAEXORFWYRCZ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCOC(=O)C1=CC=CC=C1C(=O)OCC2=CC=CC=C2 |
| CAS | 85687 |
| Splash | |
| Other Names |
Butyl benzyl phthalate; n-Butyl benzyl phthalate; Benzyl n-butyl phthalate; Phthalic acid benzyl butyl ester; Butyl phenylmethyl 1,2-benzenedicarboxylate; 1,2-Benzenedicarboxylic acid, 1-butyl 2-(phenylmethyl) ester; 1,2-Benzenedicarboxylic acid butyl phenylmethyl ester; Sicol; Palatinol BB; Spatozoate; Santicizer S 160 |
| KEGG | C14211 |
| PubChem | 2347 |
| ChemIDPlus | 000085687 |
| WebBook | 1110219178 |
| ChemSpider | 2257 |
| ChEMBL | CHEMBL1450327 |
| Wikipedia | Benzyl butyl phthalate |