Systematic / IUPAC Name: 4-(2-Ethylhexyl)-4-azatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione
ID: Reference2907
Other Names:
MGK repellent 264;
Octacide 264;
Pyrodone;
Sinepyrin 222;
Synepirin 222
; more
Formula: C17H25NO2
Class: Pesticides/Herbicides Personal Care Products/Cosmetics
MGK 264 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 924 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 7/14/2015 9:26:13 AM |
| InChI | InChI=1S/C17H25NO2/c1-3-5-6-11(4-2)10-18-16(19)14-12-7-8-13(9-12)15(14)17(18)20/h7-8,11-15H,3-6,9-10H2,1-2H3 |
| InChI Key | WLLGXSLBOPFWQV-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC(CC)CN1C(=O)C2C3CC(C2C1=O)C=C3 |
| CAS | 113484 |
| Splash | |
| Other Names |
MGK repellent 264; Octacide 264; Pyrodone; Sinepyrin 222; Synepirin 222; Synergist 264; Van dyk 264; N-(2-Ethylhexyl)-5-norbornene-2,3-dicarboximide; N-(2-Ethylhexyl)-8,9,10-trinorborn-5-ene-2,3-dicarboximide; N-2-Ethylhexyl bicycloheptenedicarboximide; N-2-Ethylhexylimide endomethylenetetrahydrophthalic acid; N-Octylbicyclo[2.2.1]-5-heptene-2,3-dicarboximide; N-Octylbicycloheptenedicarboximide; 2-(2-Ethylhexyl)-3a,4,7,7a-tetrahydro-4,7-methano-1H-isoindole-1,3(2H)-dione; 4,7-Methano-1H-isoindole-1,3(2H)-dione, 2-(2-ethylhexyl)-3a,4,7,7a-tetrahydro-; 5-Norbornene-2,3-dicarboximide, N-(2-ethylhexyl)-; Bicyclo[2.2.1]heptene-2-dicarboxylic acid, 2-ethylhexylimide; Endomethylenetetrahydrophthalic acid, N-2-ethylhexylimide |
| ChemSpider | 7934 |
| ChemIDPlus | 000113484 |
| PubChem | 8227 |
| ChEMBL | CHEMBL1874490 |
| KEGG | C18795 |