Systematic / IUPAC Name: 9-[5-(Hydroxymethyl)oxolan-2-yl]-3H-purin-6-one
ID: Reference2980
Other Names: 9-[5-(Hydroxymethyl)tetrahydrofuran-2-yl]-9H-purin-6-ol
Formula: C10H12N4O3
Class: Therapeutics/Prescription Drugs
2',3'-Dideoxyinosine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 348 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 8/25/2015 6:56:22 AM |
| InChI | InChI=1S/C10H12N4O3/c15-3-6-1-2-7(17-6)14-5-13-8-9(14)11-4-12-10(8)16/h4-7,15H,1-3H2,(H,11,12,16) |
| InChI Key | BXZVVICBKDXVGW-UHFFFAOYSA-N |
| Canonical SMILES | C1CC(OC1CO)N2C=NC3=C2NC=NC3=O |
| CAS | 69655056 |
| Splash | |
| Other Names | 9-[5-(Hydroxymethyl)tetrahydrofuran-2-yl]-9H-purin-6-ol |
| ChEMBL | CHEMBL39066 |
| PubChem | 3043 |
| ChemSpider | 2935 |