Systematic / IUPAC Name: Bis(2-ethylhexyl) phthalate
ID: Reference30
Other Names:
Diethylhexyl phthalate;
Di-2-Ethylhexyl phthalate;
1,2-Benzenedicarboxylic acid, bis(2-ethylhexyl) ester;
Phthalic acid bis(2-ethylhexyl) ester;
Bis(2-ethylhexyl) o-phthalate
; more
Formula: C24H38O4
Class: Industrial Chemicals
Bis(2-ethylhexyl) phthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 354 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 10/10/2016 11:04:24 AM |
| InChI | InChI=1S/C24H38O4/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3 |
| InChI Key | BJQHLKABXJIVAM-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC |
| CAS | 117817 |
| Splash | |
| Other Names |
Diethylhexyl phthalate; Di-2-Ethylhexyl phthalate; 1,2-Benzenedicarboxylic acid, bis(2-ethylhexyl) ester; Phthalic acid bis(2-ethylhexyl) ester; Bis(2-ethylhexyl) o-phthalate; Bis(2-ethylhexyl) 1,2-benzenedicarboxylate; Bis(2-ethylhexyl) benzene-1,2-dicarboxylate; 1,2-Benzenedicarboxylic acid bis(2-ethylhexyl) ester; Phthalic acid bis(2-ethylhexyl ester); 2-Ethylhexyl 2-[(2-ethylhexyl)oxycarbonyl]benzoate; DEHP; Fleximel; Octoil; Palatinol AH; Celluflex DOP; Vestinol AH; Bisoflex DOP; Kodaflex DOP; Staflex DOP; Truflex DOP; Flexol DOP; Vinicizer 80; Bisoflex 81; Eviplast 80; Eviplast 81; Hercoflex 260; Compound 889; RC Plasticizer DOP; Witcizer 312; Pittsburgh PX-138; Flexol plasticizer DOP; Nuoplaz DOP; Platinol AH; Platinol DOP; Hatcol DOP; Reomol DOP; Sansocizer DOP; Ergoplast FDO; Monocizer DOP; Plasthall DOP; Mollan O; Jayflex DOP; Ergoplast fdo-S; Good-rite gp 264; Reomol D 79P; BEHP; DOP |
| Wikipedia | Bis(2-ethylhexyl) phthalate |
| PubChem | 8343 |
| ChEMBL | CHEMBL1242017 |
| ChEBI | CHEBI:17747 |
| ChemSpider | 21106505 |