Systematic / IUPAC Name: Dimethyl (1E,1'E)-N,N'-{sulfanediylbis[(methylcarbamoyl)oxy]}diethanimidothioate
ID: Reference3021
Other Names:
Dicarbasulf;
(1-Methylsulfanylethylideneamino) N-methyl-N-[methyl-(1-methylsulfanyl)ethylidene ;
2,4,8-Trimethyl-5-oxo-6-oxa-3,9-dithia-2,4,7-triazadec-7-enoic acid [1-(methylthio)ethylidene]azanyl ester;
Ethanimidothioic acid, N,N'-{thiobis[(methylimino)carbonyloxy]}bis, dimethyl ester
Formula: C10H18N4O4S3
Class: Pesticides/Herbicides
Thiodicarb mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1238 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 9/23/2015 11:40:55 AM |
| InChI | InChI=1S/C10H18N4O4S3/c1-7(19-5)11-17-9(15)13(3)21-14(4)10(16)18-12-8(2)20-6/h1-6H3/b11-7+,12-8+ |
| InChI Key | XDOTVMNBCQVZKG-MKICQXMISA-N |
| Canonical SMILES | CC(=NOC(=O)N(C)SN(C)C(=O)ON=C(C)SC)SC |
| CAS | 59669260 |
| Splash | |
| Other Names |
Dicarbasulf; (1-Methylsulfanylethylideneamino) N-methyl-N-[methyl-(1-methylsulfanyl)ethylidene ; 2,4,8-Trimethyl-5-oxo-6-oxa-3,9-dithia-2,4,7-triazadec-7-enoic acid [1-(methylthio)ethylidene]azanyl ester; Ethanimidothioic acid, N,N'-{thiobis[(methylimino)carbonyloxy]}bis, dimethyl ester |
| PubChem | 9601227 |
| Wikipedia | Thiodicarb (DE) |
| ChemSpider | 7875353 |
| KEGG | C18423 |
| ChEMBL | CHEMBL1864989 |