Systematic / IUPAC Name: (4-{[(2R)-7-Methoxy-1,2,3,4-tetrahydro-2-naphthalenyl](propyl)amino}-1-piperidinyl)(4-piperidinyl)methanone
ID: Reference3044
Other Names: Methanone, 4-piperidinyl{4-[propyl((2R)-1,2,3,4-tetrahydro-7-methoxy-2-naphthalenyl)amino]-1-piperidinyl}-
Formula: C25H39N3O2
PharmaGSID 48509 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 9/29/2015 1:00:49 PM |
| InChI | InChI=1S/C25H39N3O2/c1-3-14-28(23-6-4-19-5-7-24(30-2)18-21(19)17-23)22-10-15-27(16-11-22)25(29)20-8-12-26-13-9-20/h5,7,18,20,22-23,26H,3-4,6,8-17H2,1-2H3/t23-/m1/s1 |
| InChI Key | KTAULCNFQYFKTN-HSZRJFAPSA-N |
| Canonical SMILES | CCCN(C1CCN(CC1)C(=O)C2CCNCC2)C3CCC4=C(C3)C=C(C=C4)OC |
| CAS | |
| Splash | |
| Other Names | Methanone, 4-piperidinyl{4-[propyl((2R)-1,2,3,4-tetrahydro-7-methoxy-2-naphthalenyl)amino]-1-piperidinyl}- |
| ChEMBL | CHEMBL3183939 |
| PubChem | 10287749 |
| ChemSpider | 8463218 |