Systematic / IUPAC Name: {2-[(2,6-Dichlorophenyl)amino]-5-hydroxyphenyl}acetic acid
ID: Reference3055
Other Names:
2-[(2,6-Dichloroanilino)-5-hydroxyphenyl]acetic acid;
2-[(2,6-Dichlorophenyl)amino]-5-hydroxy-benzeneacetic acid;
5-Hydroxy-diclofenac;
Acetic acid, [2-(2,6-dichloroanilino)-5-hydroxyphenyl]- ;
Benzeneacetic acid, 2-[(2,6-dichlorophenyl)amino]-5-hydroxy-
Formula: C14H11Cl2NO3
Class: Endogenous Metabolites Therapeutics/Prescription Drugs Sports Doping Drugs
5-Hydroxydiclofenac mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 122 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/29/2015 7:54:27 AM |
| InChI | InChI=1S/C14H11Cl2NO3/c15-10-2-1-3-11(16)14(10)17-12-5-4-9(18)6-8(12)7-13(19)20/h1-6,17-18H,7H2,(H,19,20) |
| InChI Key | VNQURRWYKFZKJZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)Cl)NC2=C(C=C(C=C2)O)CC(=O)O)Cl |
| CAS | 69002842 |
| Splash | |
| Other Names |
2-[(2,6-Dichloroanilino)-5-hydroxyphenyl]acetic acid; 2-[(2,6-Dichlorophenyl)amino]-5-hydroxy-benzeneacetic acid; 5-Hydroxy-diclofenac; Acetic acid, [2-(2,6-dichloroanilino)-5-hydroxyphenyl]- ; Benzeneacetic acid, 2-[(2,6-dichlorophenyl)amino]-5-hydroxy- |
| HMDb | HMDB60542 |
| ChEBI | CHEBI:59612 |
| ChemSpider | 2314362 |
| PubChem | 3052566 |
| ChemIDPlus | 069002842 |