Systematic / IUPAC Name: 2-Methyl-1,2,3,4,10,14b-hexahydropyrazino[2,1-a]pyrido[2,3-c][2]benzazepin-8-ol
ID: Reference3059
Other Names: Pyrazino[2,1-a]pyrido[2,3-c][2]benzazepin-8-ol, 1,2,3,4,10,14b-hexahydro-2-methyl-
Formula: C17H19N3O
Class: Endogenous Metabolites Therapeutics/Prescription Drugs
8-Hydroxymirtazapine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 67 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/29/2015 10:56:33 AM |
| InChI | InChI=1S/C17H19N3O/c1-19-6-7-20-16(11-19)15-5-3-2-4-12(15)8-13-9-14(21)10-18-17(13)20/h2-5,9-10,16,21H,6-8,11H2,1H3 |
| InChI Key | DAWYIZBOUQIVNX-UHFFFAOYSA-N |
| Canonical SMILES | CN1CCN2C(C1)C3=CC=CC=C3CC4=CC(=CN=C42)O |
| CAS | 102335579 |
| Splash | |
| Other Names | Pyrazino[2,1-a]pyrido[2,3-c][2]benzazepin-8-ol, 1,2,3,4,10,14b-hexahydro-2-methyl- |