Systematic / IUPAC Name: 2-(2-Aminopropanoylamino)-3-(4-hydroxyphenyl)propanoic acid
ID: Reference308
Other Names:
Aminopropanamido)-3-(4-hydroxyphenyl)propanoic acid;
Aminopropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid;
L-Alanyl-L-tyrosine;
Ala-Tyr;
Tyrosine, N-alanyl-
; more
Formula: C12H16N2O4
Class: Endogenous Metabolites
Alanyltyrosine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 298 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/12/2014 11:01:58 AM |
| InChI | InChI=1S/C12H16N2O4/c1-7(13)11(16)14-10(12(17)18)6-8-2-4-9(15)5-3-8/h2-5,7,10,15H,6,13H2,1H3,(H,14,16)(H,17,18)/t7-,10-/m0/s1 |
| InChI Key | ALZVPLKYDKJKQU-XVKPBYJWSA-N |
| Canonical SMILES | O=C(O)C(NC(=O)C(N)C)Cc1ccc(O)cc1 |
| CAS | 3061889 |
| Splash | |
| Other Names |
Aminopropanamido)-3-(4-hydroxyphenyl)propanoic acid; Aminopropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid; L-Alanyl-L-tyrosine; Ala-Tyr; Tyrosine, N-alanyl-; L-Ala-L-Tyr; N-L-Alanyl-L-tyrosine; L-Tyrosine, L-alanyl- |
| ChemIDPlus | 003061889 |
| PubChem | 92946; 7010480 |
| ChEBI | CHEBI:73395 |
| ChemSpider | 497607; 83903 |
| ChEMBL | CHEMBL94016 |