Systematic / IUPAC Name: Dipentyl benzene-1,2-dicarboxylate
ID: Reference31
Other Names:
Di-n-Pentyl phthalate;
1,2-Benzenedicarboxylic acid, dipentyl ester;
Phthalic acid dipentyl ester;
Dipentyl 1,2-benzenedicarboxylate;
1,2-Benzenedicarboxylic acid, 1,2-dipentyl ester
; more
Formula: C18H26O4
Class: Industrial Chemicals
Dipentyl phthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 235 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/3/2015 12:58:19 PM |
| InChI | InChI=1S/C18H26O4/c1-3-5-9-13-21-17(19)15-11-7-8-12-16(15)18(20)22-14-10-6-4-2/h7-8,11-12H,3-6,9-10,13-14H2,1-2H3 |
| InChI Key | IPKKHRVROFYTEK-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCC |
| CAS | 131180 |
| Splash | |
| Other Names |
Di-n-Pentyl phthalate; 1,2-Benzenedicarboxylic acid, dipentyl ester; Phthalic acid dipentyl ester; Dipentyl 1,2-benzenedicarboxylate; 1,2-Benzenedicarboxylic acid, 1,2-dipentyl ester; Pentyl 2-(pentyloxycarbonyl)benzoate; Diamyl phthalate; Amoil; Phthalic acid diamyl ester; Di-n-Amyl phthalate; DPNP; Phthalic acid, diamyl ester |
| ChEBI | CHEBI:34680 |
| PubChem | 8561 |
| WebBook | 2956162756 |
| ChEMBL | CHEMBL1503330 |
| ChemSpider | 8243 |
| ChemIDPlus | 000131180 |
| KEGG | C14300 |