Systematic / IUPAC Name: 2-[N-(2-methoxyacetyl)-2,6-dimethylanilino]propanoic acid
ID: Reference3120
Other Names:
CGA62826 ;
Metalaxyl acid;
[2 -(2,6-dimethylphenyl)-methoxyacetylamino]-propionic acid ;
Alanine, N-(2,6-dimethylphenyl)-N-(2-methoxyacetyl)-
Formula: C14H19NO4
Class: Pesticides/Herbicides Endogenous Metabolites
N-(2,6-Dimethylphenyl)-N-(methoxyacetyl) alanine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 134 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/16/2015 8:01:32 AM |
| InChI | InChI=1S/C14H19NO4/c1-9-6-5-7-10(2)13(9)15(11(3)14(17)18)12(16)8-19-4/h5-7,11H,8H2,1-4H3,(H,17,18) |
| InChI Key | ZRIKZVLHMGYCIR-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=CC=C1)C)N(C(C)C(=O)O)C(=O)COC |
| CAS | |
| Splash | |
| Other Names |
CGA62826 ; Metalaxyl acid; [2 -(2,6-dimethylphenyl)-methoxyacetylamino]-propionic acid ; Alanine, N-(2,6-dimethylphenyl)-N-(2-methoxyacetyl)- |