Systematic / IUPAC Name: (11β,16α)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl acetate
ID: Reference3155
Other Names:
Dexamethasone 21-acetate;
Dex-cortidelt acetate;
Fortecortin (crystal suspension);
Panasone;
Prednisolone F acetate
; more
Formula: C24H31FO6
Class: Therapeutics/Prescription Drugs
Dexamethasone acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 134 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/22/2015 11:41:56 AM |
| InChI | InChI=1S/C24H31FO6/c1-13-9-18-17-6-5-15-10-16(27)7-8-21(15,3)23(17,25)19(28)11-22(18,4)24(13,30)20(29)12-31-14(2)26/h7-8,10,13,17-19,28,30H,5-6,9,11-12H2,1-4H3/t13-,17+,18+,19+,21+,22+,23+,24+/m1/s1 |
| InChI Key | AKUJBENLRBOFTD-RPRRAYFGSA-N |
| Canonical SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COC(=O)C)O)C)O)F)C |
| CAS | 1177873 |
| Splash | |
| Other Names |
Dexamethasone 21-acetate; Dex-cortidelt acetate; Fortecortin (crystal suspension); Panasone; Prednisolone F acetate; (11b,16a)-9-Fluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione 21-acetate; [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-Fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate; 2-((2S,10S,11S,15S,17S,1R,13R,14R)-1-Fluoro-14,17-dihydroxy-2,13,15-trimethyl-5-oxotetracyclo[8.7.0.0.0]heptadeca-3,6-dien-14-yl)-2-oxoethyl ace tate; 9α-Fluoro-16α-methyl-11β,17α,21-trihydroxy-1,4-pregnadiene-3,20-dione-21-acetate; 9α-Fluoro-16α-methylprednisolone-21-acetate |
| ChemSpider | 206624 |
| KEGG | C08174; D07796 |
| ChEMBL | CHEMBL1530428 |
| PubChem | 236702 |