Systematic / IUPAC Name: 4-({[4-(4-Fluorophenoxy)phenyl]sulfonyl}amino)-N-hydroxytetrahydro-2H-pyran-4-carboxamide
ID: Reference3161
Other Names: 4-[4-(4-Fluoro-phenoxy)-benzenesulfonylamino]-tetrahydro-pyran-4-carboxylic acid hydroxyamide
Formula: C18H19FN2O6S
CP-544439 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 236 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/23/2015 6:09:59 AM |
| InChI | InChI=1S/C18H19FN2O6S/c19-13-1-3-14(4-2-13)27-15-5-7-16(8-6-15)28(24,25)21-18(17(22)20-23)9-11-26-12-10-18/h1-8,21,23H,9-12H2,(H,20,22) |
| InChI Key | ZBRHTUMWSDPCMI-UHFFFAOYSA-N |
| Canonical SMILES | C1COCCC1(C(=O)NO)NS(=O)(=O)C2=CC=C(C=C2)OC3=CC=C(C=C3)F |
| CAS | 230954093 |
| Splash | |
| Other Names | 4-[4-(4-Fluoro-phenoxy)-benzenesulfonylamino]-tetrahydro-pyran-4-carboxylic acid hydroxyamide |
| ChemSpider | 8041941 |
| PubChem | 9866250 |
| ChEMBL | CHEMBL111856 |