Systematic / IUPAC Name: 4-(2-Amino-1-hydroxyethyl)-1,2-benzenediol
ID: Reference318
Other Names:
(R)-4-(2-Amino-1-hydroxyethyl)-1,2-benzenediol;
Benzyl alcohol, α-(aminomethyl)-3,4-dihydroxy-, (-)-;
1,2-Benzenediol, 4-(2-amino-1-hydroxyethyl)-, (R)-;
Arterenol;
Levophed
; more
Formula: C8H11NO3
Class: Endogenous Metabolites
Norepinephrine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 405 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 10/23/2025 9:09:21 AM |
| InChI | InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/t8-/m0/s1 |
| InChI Key | SFLSHLFXELFNJZ-QMMMGPOBSA-N |
| Canonical SMILES | Oc1ccc(cc1O)C(O)CN |
| CAS | 138658 |
| Splash | |
| Other Names |
(R)-4-(2-Amino-1-hydroxyethyl)-1,2-benzenediol; Benzyl alcohol, α-(aminomethyl)-3,4-dihydroxy-, (-)-; 1,2-Benzenediol, 4-(2-amino-1-hydroxyethyl)-, (R)-; Arterenol; Levophed; Levonor; Levonorepinephrine; Adrenor; Aktamin; Levonoradrenaline; Levoarterenol; Noradrenalin; Norepirenamine; Norepinefrina; Norartrinal |
| PubChem | 439260 |
| HMDb | HMDB00216 |
| ChemSpider | 926 |
| DrugBank | 439260; APRD01299 |
| KEGG | C00547; D00076 |
| Wikipedia | Norepinephrine |
| ChEBI | CHEBI:18357 |
| ChEMBL | CHEMBL1437 |