Systematic / IUPAC Name: 5-(Dithiolan-3-yl)pentanoic acid
ID: Reference319
Other Names:
Thiooctanoic acid;
1,2-Dithiolane-3-valerate;
Thioctanoic acid;
5-(Dithiolan-3-yl)valerate;
1,2-Dithiolane-3-pentanoate
; more
Formula: C8H14O2S2
Class: Endogenous Metabolites
Lipoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 505 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 5/11/2026 9:18:39 AM |
| InChI | InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10)/t7-/m1/s1 |
| InChI Key | AGBQKNBQESQNJD-SSDOTTSWSA-N |
| Canonical SMILES | C1CSSC1CCCCC(=O)O |
| CAS | 1077287 |
| Splash | |
| Other Names |
Thiooctanoic acid; 1,2-Dithiolane-3-valerate; Thioctanoic acid; 5-(Dithiolan-3-yl)valerate; 1,2-Dithiolane-3-pentanoate; 5-(1,2-Dithiolan-3-yl)valerate; 5-(1,2-Dithiolan-3-yl)pentanoate; δ-[3-(1,2-Dithiacyclopentyl)]pentanoate; δ-[3-(1,2-Dithiacyclopentyl)]pentanoic acid; Heparlipon; Lipoate; Thioctsan; Thioctidase; Protogen A; Liponate; Thioctate; 6-Thioctate; 6-Thiotate; Tioctidasi acetate replacing factor; α-Lipoic acid |
| ChEBI | CHEBI:30314 |
| ChemSpider | 5886 |
| ChEMBL | CHEMBL134342 |
| PubChem | 6112 |
| Wikipedia | Lipoic acid |
| KEGG | C00725; D00086; C16241 |
| HMDb | HMDB01451 |
| LipidsMAPs | LMFA01130001 |
| ChemIDPlus | 000062464; 001200222 |