Systematic / IUPAC Name: Dibutyl benzene-1,2-dicarboxylate
ID: Reference32
Other Names:
Di-n-Butyl phthalate;
n-Butyl phthalate;
Butyl phthalate;
Dibutyl-o-phthalate;
o-Dibutyl phthalate
; more
Formula: C16H22O4
Class: Extractables/Leachables Industrial Chemicals
Dibutyl phthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS ; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 8 |
| No. of Spectra | 1135 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 9:38:46 AM |
| InChI | InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 |
| InChI Key | DOIRQSBPFJWKBE-UHFFFAOYSA-N |
| Canonical SMILES | CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC |
| CAS | 84742 |
| Splash | |
| Other Names |
Di-n-Butyl phthalate; n-Butyl phthalate; Butyl phthalate; Dibutyl-o-phthalate; o-Dibutyl phthalate; Di-n-Butylorthophthalate; o-Benzenedicarboxylic acid dibutyl ester; Dibutylphthatlate; Phthalic acid di-n-butyl ester; Dibutyl-1,2-benzenedicarboxylate; Benzenedicarboxylic acid dibutyl ester; 1,2-Benzenedicarboxylic acid dibutyl ester; 1,2-Dibutyl benzene-1,2-dicarboxylate; Celluflex DPB; Elaol; Genoplast B; Palatinol C; Polycizer DBP; Unimoll DB; DBP; Staflex DBP; Hexaplas M/B; Witcizer 300; Ergoplast FDB; Ersoplast FDA; Kodaflex DBP; Uniflex DBP; Hatcol DBP; RC Plasticizer DBP; Rapidcelltrade markp |
| Wikipedia | Dibutyl phthalate |
| ChemSpider | 13837319 |
| ChEBI | CHEBI:34687 |
| ChEMBL | CHEMBL272485 |
| PubChem | 3026 |