Systematic / IUPAC Name: (2R)-2,5,7,8-Tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-6-chromanol
ID: Reference328
Other Names:
α-δ-Tocopherol;
α-Vitamin E;
(+)-α-Tocopherol;
(R,R,R)-α-Tocopherol;
Aquasol E
; more
Formula: C29H50O2
Class: Steroids/Vitamins/Hormones Endogenous Metabolites Extractables/Leachables
D-α-Tocopherol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap Fusion Lumos with ETD LBP FAIMS ; Q Exactive Orbitrap |
| No. of Spectral Trees | 6 |
| No. of Spectra | 1867 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | IT; FT |
| Last Modification | 3/28/2018 8:59:33 AM |
| InChI | InChI=1S/C29H50O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h20-22,30H,9-19H2,1-8H3/t21-,22-,29-/m1/s1 |
| InChI Key | GVJHHUAWPYXKBD-IEOSBIPESA-N |
| Canonical SMILES | CC1=C(C(=C2CCC(OC2=C1C)(C)CCCC(C)CCCC(C)CCCC(C)C)C)O |
| CAS | 59029 |
| Splash | |
| Other Names |
α-δ-Tocopherol; α-Vitamin E; (+)-α-Tocopherol; (R,R,R)-α-Tocopherol; Aquasol E; Denamone; Ephanyl; Esorb; Ido-E; Pheryl-E; Phytogermin; Phytogermine; Vitamin E (D-form); Viteolin; VIV; (R)-2,5,7,8-Tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-ol ; (2R)-2-[(4R,8R)-4,8,12-Trimethyltridecyl]-2,5,7,8-tetramethylchroman-6-ol ; (2R)-2,5,7,8-Tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-ol; (2R)-2,5,7,8-Tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-ol; (2R)-2,5,7,8-Tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]chroman-6-ol ; (2R)-3,4-Dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-ol; [2R*(4R*,8R*)]-(1)-3,4-Dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-2H-benzopyran-6-ol ; 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, (2R)-; 3,4-Dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-2H-benzopyran-6-ol; 5,7,8-Trimethyltocol; 6-Chromanol, 2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-; Amino-opti-E |
| HMDb | HMDB01893 |
| ChemSpider | 14265 |
| PubChem | 14985 |
| ChemIDPlus | 001406184; 010191410; 002074535 |
| KEGG | C02477; D02331 |
| ChEBI | CHEBI:18145 |
| Wikipedia | alpha-Tocopherol |
| DrugBank | DB00163 |
| LipidsMAPs | LMPR02020001 |