Systematic / IUPAC Name: Dicyclohexyl benzene-1,2-dicarboxylate
ID: Reference33
Other Names:
Phthalic acid dicyclohexyl ester;
Diclohexyl 1,2-benzenedicarboxylate;
Unimoll 66;
Howflex CP;
DCHP
Formula: C20H26O4
Class: Extractables/Leachables Industrial Chemicals
Dicyclohexyl phthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1283 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 3/29/2019 8:46:54 AM |
| InChI | InChI=1S/C20H26O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16/h7-8,13-16H,1-6,9-12H2 |
| InChI Key | VOWAEIGWURALJQ-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)OC(=O)C2=CC=CC=C2C(=O)OC3CCCCC3 |
| CAS | 84617 |
| Splash | |
| Other Names |
Phthalic acid dicyclohexyl ester; Diclohexyl 1,2-benzenedicarboxylate; Unimoll 66; Howflex CP; DCHP |
| ChemIDPlus | 000084617 |
| PubChem | 6777 |
| KEGG | C14529 |
| ChemSpider | 6519 |
| WebBook | 1892989497 |