Systematic / IUPAC Name: 4-Nitrophenyl 2-acetamido-2-deoxy-α-D-glucopyranoside
ID: Reference3334
Other Names:
N-[(2R,3R,4R,5S,6R)-4,5-Dihydroxy-6-(hydroxymethyl)-2-(4-nitrophenoxy)tetrahydro-2H-pyran-3-yl]acetamide ;
p-Nitrophenyl 2-acetamido-2-deoxy-α-D-glucopyranoside;
4-Nitrophenyl N-acetyl-α-D-glucosaminide;
4'-Nitrophenyl-2-acetamido-2-deoxy-α-D-glucopyranoside
Formula: C14H18N2O8
Class: Endogenous Metabolites
4-Nitrophenyl 2-acetamido-2-deoxy-α-D-glucopyranoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 190 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/12/2015 6:51:54 AM |
| InChI | InChI=1S/C14H18N2O8/c1-7(18)15-11-13(20)12(19)10(6-17)24-14(11)23-9-4-2-8(3-5-9)16(21)22/h2-5,10-14,17,19-20H,6H2,1H3,(H,15,18)/t10-,11-,12-,13-,14+/m1/s1 |
| InChI Key | OMRLTNCLYHKQCK-KSTCHIGDSA-N |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2=CC=C(C=C2)[N+](=O)[O-])CO)O)O |
| CAS | 10139023 |
| Splash | |
| Other Names |
N-[(2R,3R,4R,5S,6R)-4,5-Dihydroxy-6-(hydroxymethyl)-2-(4-nitrophenoxy)tetrahydro-2H-pyran-3-yl]acetamide ; p-Nitrophenyl 2-acetamido-2-deoxy-α-D-glucopyranoside; 4-Nitrophenyl N-acetyl-α-D-glucosaminide; 4'-Nitrophenyl-2-acetamido-2-deoxy-α-D-glucopyranoside |