Systematic / IUPAC Name: 6-Chloro-7-nitroquinoxaline
ID: Reference3353
Other Names: 7-Chloro-6-nitroquinoxaline
Formula: C8H4ClN3O2
6-Chloro-7-nitroquinoxaline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 11/12/2015 2:28:53 PM |
| InChI | InChI=1S/C8H4ClN3O2/c9-5-3-6-7(11-2-1-10-6)4-8(5)12(13)14/h1-4H |
| InChI Key | GVENYEPMSTYETH-UHFFFAOYSA-N |
| Canonical SMILES | C1=NC2=CC(=C(C=C2N=C1)Cl)[N+](=O)[O-] |
| CAS | 109541211 |
| Splash | |
| Other Names | 7-Chloro-6-nitroquinoxaline |