Systematic / IUPAC Name: 4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine
ID: Reference3373
Other Names:
1-Naphthalenamine, 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-;
N-Desmethylsertraline
Formula: C16H15Cl2N
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Norsertraline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 67 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/23/2015 9:42:17 AM |
| InChI | InChI=1S/C16H15Cl2N/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13/h1-5,7,9,11,16H,6,8,19H2 |
| InChI Key | SRPXSILJHWNFMK-UHFFFAOYSA-N |
| Canonical SMILES | C1CC(C2=CC=CC=C2C1C3=CC(=C(C=C3)Cl)Cl)N |
| CAS | 87857418 |
| Splash | |
| Other Names |
1-Naphthalenamine, 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-; N-Desmethylsertraline |
| Wikipedia | Desmethylsertraline |
| PubChem | 577181 |
| ChemSpider | 501757 |
| HMDb | HMDB61002 |