Systematic / IUPAC Name: N-Ethyl-N-nitroso-1-[3-(trifluoromethyl)phenyl]-2-propanamine
ID: Reference3383
Other Names: Benzeneethanamine, N-ethyl-α-methyl-N-nitroso-3-(trifluoromethyl)-
Formula: C12H15F3N2O
Class: Natural Products/Medicines Illegal Additives
N-Nitrosofenfluramine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 67 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/20/2015 7:06:22 AM |
| InChI | InChI=1S/C12H15F3N2O/c1-3-17(16-18)9(2)7-10-5-4-6-11(8-10)12(13,14)15/h4-6,8-9H,3,7H2,1-2H3 |
| InChI Key | JVGWNJLSTCQSCZ-UHFFFAOYSA-N |
| Canonical SMILES | CCN(C(C)Cc1cccc(c1)C(F)(F)F)N=O |
| CAS | 19023406 |
| Splash | |
| Other Names | Benzeneethanamine, N-ethyl-α-methyl-N-nitroso-3-(trifluoromethyl)- |
| ChemSpider | 27523939 |