Systematic / IUPAC Name: N-Octanoylglycine
ID: Reference339
Other Names:
2-Octanamidoacetic acid;
N-(1-Oxooctyl)glycine;
Glycine, N-(1-oxooctyl)-;
2-(Octanoylamino)acetic acid;
Caprylylglycine
Formula: C10H19NO3
Class: Endogenous Metabolites
Capryloylglycine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 622 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/18/2014 10:56:47 AM |
| InChI | InChI=1S/C10H19NO3/c1-2-3-4-5-6-7-9(12)11-8-10(13)14/h2-8H2,1H3,(H,11,12)(H,13,14) |
| InChI Key | SAVLIIGUQOSOEP-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCC(=O)NCC(=O)O |
| CAS | 14246538 |
| Splash | |
| Other Names |
2-Octanamidoacetic acid; N-(1-Oxooctyl)glycine; Glycine, N-(1-oxooctyl)-; 2-(Octanoylamino)acetic acid; Caprylylglycine |
| ChemIDPlus | 014246538 |
| ChEBI | CHEBI:74099 |
| PubChem | 84290 |
| HMDb | HMDB00832 |
| ChemSpider | 76040 |