Systematic / IUPAC Name: Diethyl benzene-1,2-dicarboxylate
ID: Reference34
Other Names:
Phthalic acid diethyl ester;
Diethyl o-phthalate;
Diethyl 1,2-benzenedicarboxylate;
o-Bis(ethoxycarbonyl)benzene;
Diethyl benzene-1,2-dicarboxylate
; more
Formula: C12H14O4
Class: Industrial Chemicals
Diethyl phthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 185 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/3/2015 1:46:16 PM |
| InChI | InChI=1S/C12H14O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-8H,3-4H2,1-2H3 |
| InChI Key | FLKPEMZONWLCSK-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=CC=CC=C1C(=O)OCC |
| CAS | 84662 |
| Splash | |
| Other Names |
Phthalic acid diethyl ester; Diethyl o-phthalate; Diethyl 1,2-benzenedicarboxylate; o-Bis(ethoxycarbonyl)benzene; Diethyl benzene-1,2-dicarboxylate; Phthalic acid, diethyl ester; 1,2-Diethyl phthalate; o-Benzenedicarboxylic acid diethyl ester; 1,2-Benzenedicarboxylic acid diethyl ester; Benzene-1,2-dicarboxylic acid diethyl ester; Anozol; Neantine; Phthalol; Solvanol; Palatinol A; Unimoll DA |
| ChEMBL | CHEMBL388558 |
| Wikipedia | Diethyl_phthalate |
| ChEBI | CHEBI:34698 |
| ChemSpider | 13837303 |
| PubChem | 6781 |