Systematic / IUPAC Name: 2-{(1E)-N-[2-(4-Chlorophenoxy)propoxy]butanimidoyl}-3-hydroxy-5-(tetrahydro-2H-thiopyran-3-yl)-2-cyclohexen-1-one
ID: Reference3429
Other Names:
E-Profoxydim;
2-Cyclohexen-1-one, 2-((1E)-1-{[2-(4-chlorophenoxy)propoxy]imino}butyl)-3-hydroxy-5-(tetrahydro-2H-thiopyran-3-yl)-
Formula: C24H32ClNO4S
Class: Pesticides/Herbicides
Profoxydim mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 67 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/27/2015 7:28:51 AM |
| InChI | InChI=1S/C24H32ClNO4S/c1-3-5-21(26-29-14-16(2)30-20-9-7-19(25)8-10-20)24-22(27)12-18(13-23(24)28)17-6-4-11-31-15-17/h7-10,16-18,27H,3-6,11-15H2,1-2H3/b26-21+ |
| InChI Key | KRQUFUKTQHISJB-YYADALCUSA-N |
| Canonical SMILES | Clc1ccc(cc1)OC(C)CO\N=C(/CCC)\C=2C(=O)CC(CC=2O)C3CCCSC3 |
| CAS | 139001493 |
| Splash | |
| Other Names |
E-Profoxydim; 2-Cyclohexen-1-one, 2-((1E)-1-{[2-(4-chlorophenoxy)propoxy]imino}butyl)-3-hydroxy-5-(tetrahydro-2H-thiopyran-3-yl)- |
| Wikipedia | Profoxydim |
| ChemSpider | 10608134 |