Systematic / IUPAC Name: N-[(2E)-3-Phenyl-2-propenoyl]glycine
ID: Reference345
Other Names:
2-(Cinnamoylamino)acetic acid;
N-[(2E)-3-Phenylprop-2-enoyl]glycine;
{[(2E)-3-Phenylprop-2-enoyl]amino}acetic acid;
Glycine, N-(1-oxo-3-phenyl-2-propenyl)-;
N-(1-Oxo-3-phenyl-2-propen-1-yl)-glycine
; more
Formula: C11H11NO3
Class: Endogenous Metabolites
Cinnamoylglycine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 312 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/19/2014 11:04:16 AM |
| InChI | InChI=1S/C11H11NO3/c13-10(12-8-11(14)15)7-6-9-4-2-1-3-5-9/h1-7H,8H2,(H,12,13)(H,14,15)/b7-6+ |
| InChI Key | YAADMLWHGMUGQL-VOTSOKGWSA-N |
| Canonical SMILES | C1=CC=C(C=C1)/C=C/C(=O)NCC(=O)O |
| CAS | 16534240 |
| Splash | |
| Other Names |
2-(Cinnamoylamino)acetic acid; N-[(2E)-3-Phenylprop-2-enoyl]glycine; {[(2E)-3-Phenylprop-2-enoyl]amino}acetic acid; Glycine, N-(1-oxo-3-phenyl-2-propenyl)-; N-(1-Oxo-3-phenyl-2-propen-1-yl)-glycine; 2-((2E)-3-Phenylprop-2-enoylamino)acetic acid; N-Cinnamoylglycine; Glycine, N-cinnamoyl, E- |
| ChEBI | CHEBI:68616 |
| PubChem | 709625 |
| ChemSpider | 618829 |
| ChEMBL | CHEMBL456606 |
| HMDb | HMDB11621 |
| ChemIDPlus | 016534240 |