Systematic / IUPAC Name: 4,5-Dihydroxy-9,10-dioxoanthracene-2-carboxylic acid
ID: Reference3484
Other Names:
Cassic acid;
Monorhein;
Rheic acid;
Rhubarb yellow;
1,8-Dihydroxy-3-carboxyanthraquinone
; more
Formula: C15H8O6
Class: Endogenous Metabolites Natural Products/Medicines
Rhein mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 4 |
| No. of Spectra | 6494 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 1/24/2017 8:47:31 AM |
| InChI | InChI=1S/C15H8O6/c16-9-3-1-2-7-11(9)14(19)12-8(13(7)18)4-6(15(20)21)5-10(12)17/h1-5,16-17H,(H,20,21) |
| InChI Key | FCDLCPWAQCPTKC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C(C=C(C=C3C2=O)C(=O)O)O |
| CAS | 478433 |
| Splash | |
| Other Names |
Cassic acid; Monorhein; Rheic acid; Rhubarb yellow; 1,8-Dihydroxy-3-carboxyanthraquinone; 1,8-Dihydroxy-3-carboxyl anthraquinone; 1,8-Dihydroxyanthraquinone-3-carboxylic acid; 2-Anthracenecarboxylic acid, 9,10-dihydro-4,5-dihydroxy-9,10-dioxo-; 2-Anthraquinonecarboxylic acid, 4,5-dihydroxy-; 2-Anthroic acid, 9,10-dihydro-4,5-dihydroxy-9,10-dioxo-; 4,5-Dihydroxy-2-anthraquinonecarboxylic acid; 4,5-Dihydroxy-9,10-diketo-anthracene-2-carboxylic acid; 4,5-Dihydroxy-9,10-dioxo-2-anthracenecarboxylic acid; 4,5-Dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-carboxylic acid; 4,5-Dihydroxy-9,10-dioxo-anthracene-2-carboxylic acid; 4,5-Dihydroxyanthraquinone-2-carboxylic acid; 9,10-Dihydro-4,5-dihydroxy-9,10-dioxo-2-anthracenecarboxylic acid; 9,10-Dihydro-4,5-dihydroxy-9,10-dioxo-2-anthroic acid; 9,10-Dihydro-4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid; Chrysazin-3-carboxylic acid; Dipropionyl rhein |
| PubChem | 10168 |
| ChEBI | CHEBI:8825 |
| KEGG | C10401 |
| Wikipedia | Rhein (molecule) |
| ChemSpider | 9762 |
| HMDb | HMDB32876 |