Systematic / IUPAC Name: N-[(6R,12aR)-6-(1,3-Benzodioxol-5-yl)-1,4-dioxo-3,4,6,7,12,12a-hexahydropyrazino[1',2':1,6]pyrido[3,4-b]indol-2(1H)-yl]acetamide
ID: Reference3496
Other Names: Acetamide, N-[(6R,12aR)-6-(1,3-benzodioxol-5-yl)-3,4,6,7,12,12a-hexahydro-1,4-dioxopyrazino[1',2':1,6]pyrido[3,4-b]indol-2(1H)-yl]-
Formula: C23H20N4O5
Class: Counterfeit Drug (Therapeutic) Endogenous Metabolites Therapeutics/Prescription Drugs
Acetaminotadalafil mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/22/2018 8:10:14 AM |
| InChI | InChI=1S/C23H20N4O5/c1-12(28)25-26-10-20(29)27-17(23(26)30)9-15-14-4-2-3-5-16(14)24-21(15)22(27)13-6-7-18-19(8-13)32-11-31-18/h2-8,17,22,24H,9-11H2,1H3,(H,25,28)/t17-,22-/m1/s1 |
| InChI Key | MUILQBHOQBZMPG-VGOFRKELSA-N |
| Canonical SMILES | CC(=O)NN1CC(=O)N2C(C1=O)CC3=C(C2C4=CC5=C(C=C4)OCO5)NC6=CC=CC=C36 |
| CAS | 1446144713 |
| Splash | |
| Other Names | Acetamide, N-[(6R,12aR)-6-(1,3-benzodioxol-5-yl)-3,4,6,7,12,12a-hexahydro-1,4-dioxopyrazino[1',2':1,6]pyrido[3,4-b]indol-2(1H)-yl]- |