Systematic / IUPAC Name: [6,7-Dimethoxy-1-methyl-3,4-dihydro-2(1H)-isoquinolinyl](4-methyl-1,2,3-thiadiazol-5-yl)methanone
ID: Reference3534
Other Names: 5-[(6,7-Dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-2-yl)carbonyl]-4-methyl-1,2,3-thiadiazole
Formula: C16H19N3O3S
[6,7-Dimethoxy-1-methyl-3,4-dihydro-2(1H)-isoquinolinyl](4-methyl-1,2,3-thiadiazol-5-yl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3567 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/11/2016 12:47:52 PM |
| InChI | InChI=1S/C16H19N3O3S/c1-9-15(23-18-17-9)16(20)19-6-5-11-7-13(21-3)14(22-4)8-12(11)10(19)2/h7-8,10H,5-6H2,1-4H3 |
| InChI Key | RCCPRWNFLDLOOB-UHFFFAOYSA-N |
| Canonical SMILES | CC1C2=CC(=C(C=C2CCN1C(=O)C3=C(N=NS3)C)OC)OC |
| CAS | |
| Splash | |
| Other Names | 5-[(6,7-Dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-2-yl)carbonyl]-4-methyl-1,2,3-thiadiazole |