Systematic / IUPAC Name: 3-(4-Methoxyphenyl)-5-[(4-nitrophenoxy)methyl]-4,5-dihydro-1,2-oxazole
ID: Reference3542
Other Names: Isoxazole, 4,5-dihydro-3-(4-methoxyphenyl)-5-[(4-nitrophenoxy)methyl]-
Formula: C17H16N2O5
3-(4-Methoxyphenyl)-5-[(4-nitrophenoxy)methyl]-4,5-dihydroisoxazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1962 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/12/2016 9:56:42 AM |
| InChI | InChI=1S/C17H16N2O5/c1-22-14-6-2-12(3-7-14)17-10-16(24-18-17)11-23-15-8-4-13(5-9-15)19(20)21/h2-9,16H,10-11H2,1H3 |
| InChI Key | YVQXLBJIPYSRSE-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Isoxazole, 4,5-dihydro-3-(4-methoxyphenyl)-5-[(4-nitrophenoxy)methyl]- |
| ChEMBL | CHEMBL1335991 |
| ChemSpider | 2094138 |
| PubChem | 2815774 |