Systematic / IUPAC Name: 3-(2,6-Dichlorophenyl)-5-methyl-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)-1,2-oxazole-4-carboxamide
ID: Reference3556
Other Names:
Formula: C15H10Cl2N4O5
N4-(3-Methyl-4-nitroisoxazol-5-yl)-3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 4294 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/12/2016 3:21:54 PM |
| InChI | InChI=1S/C15H10Cl2N4O5/c1-6-13(21(23)24)15(26-19-6)18-14(22)10-7(2)25-20-12(10)11-8(16)4-3-5-9(11)17/h3-5H,1-2H3,(H,18,22) |
| InChI Key | PDFUGQXQJQWLBI-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 2820275 |
| ChEMBL | CHEMBL1381228 |
| ChemSpider | 2098504 |