Systematic / IUPAC Name: 6-Iodo-2-propoxy-3-propyl-4(3H)-quinazolinone
ID: Reference3570
Other Names: 6-iodo-2-propoxy-3-propylquinazolin-4-one
Formula: C14H17IN2O2
Class: Pesticides/Herbicides
Proquinazid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 650 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/13/2016 1:23:13 PM |
| InChI | InChI=1S/C14H17IN2O2/c1-3-7-17-13(18)11-9-10(15)5-6-12(11)16-14(17)19-8-4-2/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChI Key | FLVBXVXXXMLMOX-UHFFFAOYSA-N |
| Canonical SMILES | CCCN1C(=O)C2=C(C=CC(=C2)I)N=C1OCCC |
| CAS | 189278124 |
| Splash | |
| Other Names | 6-iodo-2-propoxy-3-propylquinazolin-4-one |
| ChemSpider | 9232930 |
| Wikipedia | Proquinazid (DE) |
| PubChem | 11057771 |
| ChEBI | CHEBI:83555 |