Systematic / IUPAC Name: 1-Butyl-3-(2-phenoxyphenyl)urea
ID: Reference3573
Other Names:
3-Butyl-1-(2-phenoxyphenyl)urea;
Urea, 1-butyl-3-(2-phenoxyphenyl)-
Formula: C17H20N2O2
N-Butyl-N'-(2-phenoxyphenyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1395 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/13/2016 1:02:09 PM |
| InChI | InChI=1S/C17H20N2O2/c1-2-3-13-18-17(20)19-15-11-7-8-12-16(15)21-14-9-5-4-6-10-14/h4-12H,2-3,13H2,1H3,(H2,18,19,20) |
| InChI Key | BLJLVIBUXXHCGH-UHFFFAOYSA-N |
| Canonical SMILES | CCCCNC(=O)NC1=CC=CC=C1OC2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names |
3-Butyl-1-(2-phenoxyphenyl)urea; Urea, 1-butyl-3-(2-phenoxyphenyl)- |