Systematic / IUPAC Name: 2-{2-[4-(Dimethylamino)phenyl]vinyl}-1-methylquinolinium
ID: Reference3575
Other Names:
N,N-Dimethyl-4-[2-(1-methyl-1λ5-quinolin-2-yl)vinyl]aniline ;
N,N-Dimethyl-4-[(Z)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]aniline;
Quinolinium, 2-{2-[4-(dimethylamino)phenyl]ethenyl}-1-methyl-
Formula: C20H21N2 +
N-Methyl-N-{4-[2-(1-methylquinolinium-2-yl)vinyl]phenyl}methanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/13/2016 1:04:18 PM |
| InChI | InChI=1S/C20H21N2/c1-21(2)18-12-8-16(9-13-18)10-14-19-15-11-17-6-4-5-7-20(17)22(19)3/h4-15H,1-3H3/q+1 |
| InChI Key | NEOWNATTXBQULQ-UHFFFAOYSA-N |
| Canonical SMILES | C[N+]1=C(C=CC2=CC=CC=C21)C=CC3=CC=C(C=C3)N(C)C |
| CAS | |
| Splash | |
| Other Names |
N,N-Dimethyl-4-[2-(1-methyl-1λ5-quinolin-2-yl)vinyl]aniline ; N,N-Dimethyl-4-[(Z)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]aniline; Quinolinium, 2-{2-[4-(dimethylamino)phenyl]ethenyl}-1-methyl- |
| ChemIDPlus | 003915615 |
| ChEMBL | CHEMBL1615645 |
| ChemSpider | 437391 |
| PubChem | 7053739 |