Systematic / IUPAC Name: 2-{[1-(2-Chlorophenyl)-1H-imidazol-2-yl]sulfanyl}-3-nitropyridine
ID: Reference3582
Other Names: Pyridine, 2-{[1-(2-chlorophenyl)-1H-imidazol-2-yl]thio}-3-nitro-
Formula: C14H9ClN4O2S
2-{[1-(2-Chlorophenyl)-1H-imidazol-2-yl]thio}-3-nitropyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1410 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/13/2016 3:51:02 PM |
| InChI | InChI=1S/C14H9ClN4O2S/c15-10-4-1-2-5-11(10)18-9-8-17-14(18)22-13-12(19(20)21)6-3-7-16-13/h1-9H |
| InChI Key | VMVIGJRECBFACH-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Pyridine, 2-{[1-(2-chlorophenyl)-1H-imidazol-2-yl]thio}-3-nitro- |