Systematic / IUPAC Name: [1-(Phenylsulfonyl)-1H-indol-2-yl]methanol
ID: Reference3583
Other Names: 1H-Indole-2-methanol, 1-(phenylsulfonyl)-
Formula: C15H13NO3S
[1-(Phenylsulfonyl)-1H-indol-2-yl]methanol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 215 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/13/2016 3:48:07 PM |
| InChI | InChI=1S/C15H13NO3S/c17-11-13-10-12-6-4-5-9-15(12)16(13)20(18,19)14-7-2-1-3-8-14/h1-10,17H,11H2 |
| InChI Key | LRYLVFIUTJMZBY-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C3=CC=CC=C3C=C2CO |
| CAS | |
| Splash | |
| Other Names | 1H-Indole-2-methanol, 1-(phenylsulfonyl)- |