Systematic / IUPAC Name: 1,5-Dipyrrolidin-1-ylpentane-1,5-dione
ID: Reference3585
Other Names: 1,5-Pentanedione, 1,5-di-1-pyrrolidinyl-
Formula: C13H22N2O2
1,5-Ditetrahydro-1H-pyrrol-1-ylpentane-1,5-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 694 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/14/2016 8:02:14 AM |
| InChI | InChI=1S/C13H22N2O2/c16-12(14-8-1-2-9-14)6-5-7-13(17)15-10-3-4-11-15/h1-11H2 |
| InChI Key | KBJHHEFKAJHHGN-UHFFFAOYSA-N |
| Canonical SMILES | C1CCN(C1)C(=O)CCCC(=O)N2CCCC2 |
| CAS | |
| Splash | |
| Other Names | 1,5-Pentanedione, 1,5-di-1-pyrrolidinyl- |
| ChEMBL | CHEMBL1518854 |
| ChemSpider | 2083413 |
| PubChem | 2804873 |