Systematic / IUPAC Name: 1-(1-Benzothiophen-3-yl)-3-(3-cyclopropyl-1-methyl-1H-pyrazol-5-yl)urea
ID: Reference3586
Other Names: Urea, N-benzo[b]thien-3-yl-N'-(3-cyclopropyl-1-methyl-1H-pyrazol-5-yl)-
Formula: C16H16N4OS
N-(1-Benzothiophen-3-yl)-N'-(3-cyclopropyl-1-methyl-1H-pyrazol-5-yl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 819 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/14/2016 8:10:19 AM |
| InChI | InChI=1S/C16H16N4OS/c1-20-15(8-12(19-20)10-6-7-10)18-16(21)17-13-9-22-14-5-3-2-4-11(13)14/h2-5,8-10H,6-7H2,1H3,(H2,17,18,21) |
| InChI Key | IYLAYFSWQOFNKA-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2CC2)NC(=O)NC3=CSC4=CC=CC=C43 |
| CAS | |
| Splash | |
| Other Names | Urea, N-benzo[b]thien-3-yl-N'-(3-cyclopropyl-1-methyl-1H-pyrazol-5-yl)- |